CAS 898790-88-0
:(3-chloro-4-fluoro-phenyl)-cyclobutyl-methanone
Description:
(3-Chloro-4-fluoro-phenyl)-cyclobutyl-methanone, with the CAS number 898790-88-0, is an organic compound characterized by its unique structure that includes a cyclobutyl group and a phenyl ring substituted with chlorine and fluorine atoms. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and stability. The presence of halogen substituents, specifically chlorine and fluorine, can enhance lipophilicity and alter the electronic properties of the molecule, potentially affecting its biological activity and interaction with other substances. The cyclobutyl moiety contributes to the rigidity of the structure, which may impact its conformational dynamics. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in synthetic pathways. Additionally, the specific arrangement of substituents can lead to unique physical properties, such as melting and boiling points, solubility, and spectral characteristics, which are essential for further characterization and application in various fields.
Formula:C11H10ClFO
InChI:InChI=1/C11H10ClFO/c12-9-6-8(4-5-10(9)13)11(14)7-2-1-3-7/h4-7H,1-3H2
SMILES:C1CC(C1)C(=O)c1ccc(c(c1)Cl)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.