CAS 898790-90-4

1-(4-chloro-3-fluoro-phenyl)-3-(m-tolyl)propan-1-one

Description:

1-(4-chloro-3-fluoro-phenyl)-3-(m-tolyl)propan-1-one, with the CAS number 898790-90-4, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone, where a phenyl ring substituted with both chlorine and fluorine atoms is attached to one end, while a meta-tolyl group is present on the other. The presence of halogen substituents, specifically chlorine and fluorine, can influence the compound's reactivity, polarity, and overall chemical behavior, making it of interest in various synthetic applications. The molecular structure suggests potential uses in pharmaceuticals or agrochemicals, where such modifications can enhance biological activity or selectivity. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by its molecular weight and the nature of its substituents. Overall, this compound exemplifies the complexity and diversity of organic chemistry, particularly in the design of molecules with specific functional properties.

Formula: C₁₆H₁₄ClFO

InChI: InChI=1/C16H14ClFO/c1-11-3-2-4-12(9-11)5-8-16(19)13-6-7-14(17)15(18)10-13/h2-4,6-7,9-10H,5,8H2,1H3

SMILES: Cc1cccc(CCC(=O)c2ccc(c(c2)F)Cl)c1