CAS 898790-94-8
:cyclobutyl-(2-fluorophenyl)methanone
Description:
Cyclobutyl-(2-fluorophenyl)methanone, identified by its CAS number 898790-94-8, is an organic compound characterized by its unique structural features. It contains a cyclobutyl group, which is a four-membered carbon ring, and a 2-fluorophenyl group, indicating the presence of a fluorine atom on the second carbon of a phenyl ring. This compound is categorized as a ketone due to the presence of a carbonyl group (C=O) attached to the methanone moiety. The presence of the fluorine atom can influence the compound's reactivity and polarity, potentially enhancing its biological activity or solubility in various solvents. Cyclobutyl-(2-fluorophenyl)methanone may exhibit interesting properties such as specific melting and boiling points, solubility characteristics, and reactivity patterns typical of ketones and substituted aromatic compounds. Its applications could span fields such as pharmaceuticals, agrochemicals, or materials science, depending on its specific chemical behavior and interactions with other substances. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C11H11FO
InChI:InChI=1/C11H11FO/c12-10-7-2-1-6-9(10)11(13)8-4-3-5-8/h1-2,6-8H,3-5H2
SMILES:c1ccc(c(c1)C(=O)C1CCC1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.