CAS 898790-95-9

4-Iodo-δ-oxobenzenepentanoic acid

Description:

4-Iodo-δ-oxobenzenepentanoic acid is a chemical compound characterized by its unique structure, which includes an iodo substituent and a pentanoic acid moiety. The presence of the iodo group typically enhances the compound's reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The δ-oxobenzene structure indicates that the compound features a ketone functional group adjacent to a benzene ring, which can influence its chemical properties, such as polarity and solubility. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the development of pharmaceuticals. Its molecular interactions can be influenced by the presence of the iodo atom, which can participate in halogen bonding and affect the compound's overall stability and reactivity. As with many organic compounds, safety and handling precautions should be observed, as the iodo group can pose specific hazards. Overall, 4-Iodo-δ-oxobenzenepentanoic acid represents a versatile compound in the field of organic chemistry.

Formula: C₁₁H₁₁IO₃

InChI: InChI=1/C11H11IO3/c12-9-6-4-8(5-7-9)10(13)2-1-3-11(14)15/h4-7H,1-3H2,(H,14,15)

InChI key: InChIKey=AJIJFBZEGHQKQL-UHFFFAOYSA-N

SMILES: C(CCCC(O)=O)(=O)C1=CC=C(I)C=C1

Synonyms:

• 4-Iodo-δ-oxobenzenepentanoic acid
• Benzenepentanoic acid, 4-iodo-δ-oxo-