CAS 898790-97-1

Cyclobutyl[3-(trifluoromethyl)phenyl]methanone

Description:

Cyclobutyl[3-(trifluoromethyl)phenyl]methanone is an organic compound characterized by its unique structure, which includes a cyclobutyl group and a trifluoromethyl-substituted phenyl moiety attached to a ketone functional group. This compound typically exhibits a solid state at room temperature and is likely to be relatively stable under standard conditions. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and interaction with biological systems. The ketone functional group suggests potential reactivity in nucleophilic addition reactions, while the cyclobutyl ring may impart strain, affecting the compound's overall stability and reactivity. Additionally, the trifluoromethyl group can enhance the compound's electronic properties, making it of interest in various chemical applications, including medicinal chemistry and materials science. Safety data and handling precautions should be considered, as with any chemical substance, due to potential toxicity or environmental impact.

Formula: C₁₂H₁₁F₃O

InChI: InChI=1S/C12H11F3O/c13-12(14,15)10-6-2-5-9(7-10)11(16)8-3-1-4-8/h2,5-8H,1,3-4H2

InChI key: InChIKey=NFDLJCDOBKDNDT-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C(F)(F)F)=CC=C1)C2CCC2

Synonyms:

• Methanone, cyclobutyl[3-(trifluoromethyl)phenyl]-
• Cyclobutyl[3-(trifluoromethyl)phenyl]methanone

Cyclobutyl 3-trifluoromethylphenyl ketone

CAS: 898790-97-1

Formula: C₁₂H₁₁F₃O

Purity: 97.0%

Molecular weight: 228.214

Ref: 10-F204089