CAS 898790-99-3

1-(2-fluorophenyl)-3-(m-tolyl)propan-1-one

Description:

1-(2-Fluorophenyl)-3-(m-tolyl)propan-1-one, with the CAS number 898790-99-3, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with a 2-fluorophenyl group and a m-tolyl group, contributing to its unique chemical properties. The presence of the fluorine atom enhances its reactivity and can influence its electronic characteristics, making it potentially useful in various chemical reactions and applications. This compound is typically characterized by its molecular structure, which includes a carbonyl group (C=O) that is central to its reactivity. It may exhibit moderate to high lipophilicity due to the aromatic substituents, which can affect its solubility in organic solvents. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can interact with biological targets. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₁₆H₁₅FO

InChI: InChI=1/C16H15FO/c1-12-5-4-6-13(11-12)9-10-16(18)14-7-2-3-8-15(14)17/h2-8,11H,9-10H2,1H3

SMILES: Cc1cccc(CCC(=O)c2ccccc2F)c1