CAS 898791-00-9
:(4-bromo-2-fluoro-phenyl)-cyclobutyl-methanone
Description:
(4-bromo-2-fluoro-phenyl)-cyclobutyl-methanone is an organic compound characterized by its unique structure, which includes a cyclobutyl group and a phenyl ring substituted with both bromine and fluorine atoms. The presence of these halogens can significantly influence the compound's reactivity, polarity, and overall chemical behavior. The cyclobutyl moiety contributes to the compound's rigidity and strain, which can affect its conformational stability and interactions with other molecules. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Additionally, the presence of the ketone functional group (methanone) suggests potential for further chemical reactivity, such as nucleophilic attacks or condensation reactions. Its molecular structure and substituents can also impact its solubility, boiling point, and melting point, which are important for applications in various chemical processes. Overall, (4-bromo-2-fluoro-phenyl)-cyclobutyl-methanone represents a complex and potentially versatile compound in organic synthesis and drug development.
Formula:C11H10BrFO
InChI:InChI=1/C11H10BrFO/c12-8-4-5-9(10(13)6-8)11(14)7-2-1-3-7/h4-7H,1-3H2
SMILES:C1CC(C1)C(=O)c1ccc(cc1F)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.