CAS 898791-02-1

1-Propanone, 3-(3-methylphenyl)-1-[2-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-(3-methylphenyl)-1-[2-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-methylphenyl group and a 2-(trifluoromethyl)phenyl group. The presence of the trifluoromethyl group enhances its electron-withdrawing properties, potentially influencing its reactivity and solubility in various solvents. The compound is likely to exhibit moderate volatility and may have a relatively low boiling point due to the presence of the ketone functional group. Its aromatic rings contribute to stability and may also affect its interaction with biological systems, making it of interest in pharmaceutical and chemical research. Additionally, the presence of fluorine atoms can impart unique properties, such as increased lipophilicity and altered metabolic pathways. Overall, this compound's structure suggests potential applications in organic synthesis and material science, although specific data on its physical and chemical properties would be necessary for detailed applications.

Formula: C₁₇H₁₅F₃O

InChI: InChI=1S/C17H15F3O/c1-12-5-4-6-13(11-12)9-10-16(21)14-7-2-3-8-15(14)17(18,19)20/h2-8,11H,9-10H2,1H3

InChI key: InChIKey=PTEOWQMPIIKHSA-UHFFFAOYSA-N

SMILES: C(CCC1=CC(C)=CC=C1)(=O)C2=C(C(F)(F)F)C=CC=C2

Synonyms:

• 1-Propanone, 3-(3-methylphenyl)-1-[2-(trifluoromethyl)phenyl]-
• 3-(3-Methylphenyl)-2′-trifluoromethylpropiophenone
• 3-(3-Methylphenyl)-1-[2-(trifluoromethyl)phenyl]-1-propanone