CAS 898791-03-2
:(2-chloro-4-fluoro-phenyl)-cyclobutyl-methanone
Description:
(2-Chloro-4-fluoro-phenyl)-cyclobutyl-methanone, identified by its CAS number 898791-03-2, is a chemical compound characterized by its unique structure, which includes a cyclobutyl group and a phenyl ring substituted with chlorine and fluorine atoms. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of halogen substituents, specifically chlorine and fluorine, can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the cyclobutyl moiety may impart strain and affect the compound's overall reactivity. Such compounds are often of interest in medicinal chemistry and materials science due to their potential biological activity and utility in synthesizing more complex molecules. As with many organic compounds, its solubility, melting point, and boiling point would depend on the specific conditions and the presence of other functional groups or solvents.
Formula:C11H10ClFO
InChI:InChI=1/C11H10ClFO/c12-10-6-8(13)4-5-9(10)11(14)7-2-1-3-7/h4-7H,1-3H2
SMILES:C1CC(C1)C(=O)c1ccc(cc1Cl)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.