CAS 898791-04-3
:8-oxo-8-[2-(trifluoromethyl)phenyl]octanoic acid
Description:
8-Oxo-8-[2-(trifluoromethyl)phenyl]octanoic acid is a synthetic organic compound characterized by its unique structure, which includes an octanoic acid backbone with an oxo group and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both fatty acids and aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the oxo group. The trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical and agrochemical research. The presence of the oxo group can also impart specific reactivity, allowing for further chemical modifications. Additionally, the compound may exhibit interesting interactions in biological systems, potentially affecting enzyme activity or cellular processes. Overall, 8-oxo-8-[2-(trifluoromethyl)phenyl]octanoic acid represents a versatile structure with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C15H17F3O3
InChI:InChI=1/C15H17F3O3/c16-15(17,18)12-8-6-5-7-11(12)13(19)9-3-1-2-4-10-14(20)21/h5-8H,1-4,9-10H2,(H,20,21)
SMILES:C(CCCC(=O)O)CCC(=O)c1ccccc1C(F)(F)F
Synonyms:- 8-OXO-8-(2-TRIFLUOROMETHYLPHENYL)OCTANOIC ACID
- Benzeneoctanoic acid, η-oxo-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.