CAS 898791-05-4

1-Propanone, 3-(3-methylphenyl)-1-[3-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-(3-methylphenyl)-1-[3-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-methylphenyl group and a 3-(trifluoromethyl)phenyl group. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and interactions with biological systems. The compound is likely to be a solid or liquid at room temperature, depending on its molecular weight and structure. Its unique combination of functional groups may impart specific characteristics such as increased stability, altered boiling and melting points, and distinctive spectral properties in techniques like NMR and IR spectroscopy. Additionally, due to the presence of fluorine atoms, it may exhibit unique behavior in terms of solubility and reactivity compared to non-fluorinated analogs. Overall, this compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or materials science.

Formula: C₁₇H₁₅F₃O

InChI: InChI=1S/C17H15F3O/c1-12-4-2-5-13(10-12)8-9-16(21)14-6-3-7-15(11-14)17(18,19)20/h2-7,10-11H,8-9H2,1H3

InChI key: InChIKey=AQHSSVQDUKLMSJ-UHFFFAOYSA-N

SMILES: C(CCC1=CC(C)=CC=C1)(=O)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• 3-(3-Methylphenyl)-3′-trifluoromethylpropiophenone
• 1-Propanone, 3-(3-methylphenyl)-1-[3-(trifluoromethyl)phenyl]-
• 3-(3-Methylphenyl)-1-[3-(trifluoromethyl)phenyl]-1-propanone

3-(3-methylphenyl)-3′-trifluoromethylpropiophenone

CAS: 898791-05-4

Formula: C₁₇H₁₅F₃O

Purity: 97.0%

Molecular weight: 292.301

Ref: 10-F205703