CAS 898791-07-6

8-oxo-8-[3-(trifluoromethyl)phenyl]octanoic acid

Description:

8-Oxo-8-[3-(trifluoromethyl)phenyl]octanoic acid is a synthetic organic compound characterized by its unique structure, which includes an octanoic acid backbone with a ketone functional group and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both fatty acids and aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the ketone and carboxylic acid functional groups. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical research. Additionally, the presence of the ketone may contribute to its potential as a reactive intermediate in various chemical reactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. As with many synthetic compounds, safety and handling precautions should be observed, given the presence of fluorinated groups, which can impart unique toxicological properties.

Formula: C₁₅H₁₇F₃O₃

InChI: InChI=1/C15H17F3O3/c16-15(17,18)12-7-5-6-11(10-12)13(19)8-3-1-2-4-9-14(20)21/h5-7,10H,1-4,8-9H2,(H,20,21)

SMILES: C(CCCC(=O)O)CCC(=O)c1cccc(c1)C(F)(F)F