CAS 898791-12-3: cyclobutyl-(2,3-dichlorophenyl)methanone

Description:Cyclobutyl-(2,3-dichlorophenyl)methanone, identified by its CAS number 898791-12-3, is an organic compound characterized by its unique structure that includes a cyclobutyl group and a dichlorophenyl moiety. This compound typically exhibits a solid state at room temperature and is likely to be relatively stable under standard conditions. The presence of the dichlorophenyl group suggests that it may possess significant lipophilicity, which can influence its solubility in organic solvents. The cyclobutyl ring contributes to its three-dimensional conformation, potentially affecting its reactivity and interactions with biological targets. Additionally, the dichloro substituents can enhance the compound's electronic properties, possibly impacting its reactivity in electrophilic or nucleophilic reactions. As with many organic compounds, safety data should be consulted to understand its toxicity, handling precautions, and environmental impact. Overall, cyclobutyl-(2,3-dichlorophenyl)methanone is of interest in various fields, including medicinal chemistry and materials science, due to its structural features and potential applications.

Formula:C₁₁H₁₀Cl₂O

InChI:InChI=1/C11H10Cl2O/c12-9-6-2-5-8(10(9)13)11(14)7-3-1-4-7/h2,5-7H,1,3-4H2