CymitQuimica logo

CAS 898791-13-4

:

6-(2,3-dichlorophenyl)-6-oxo-hexanoic acid

Description:
6-(2,3-Dichlorophenyl)-6-oxo-hexanoic acid, identified by its CAS number 898791-13-4, is a chemical compound characterized by its unique structure, which includes a hexanoic acid backbone with a ketone functional group and a dichlorophenyl substituent. This compound typically exhibits properties associated with both carboxylic acids and ketones, such as acidity and potential reactivity in various chemical reactions. The presence of the dichlorophenyl group may impart specific biological activities or enhance lipophilicity, influencing its solubility and interaction with biological systems. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups are often associated with bioactivity. Additionally, the dichlorination may affect its environmental persistence and toxicity profile. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used or studied. Proper handling and safety measures should be observed due to the presence of chlorine atoms, which can pose health and environmental risks.
Formula:C12H12Cl2O3
InChI:InChI=1/C12H12Cl2O3/c13-9-5-3-4-8(12(9)14)10(15)6-1-2-7-11(16)17/h3-5H,1-2,6-7H2,(H,16,17)
SMILES:C(CCC(=O)O)CC(=O)c1cccc(c1Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.