CymitQuimica logo

CAS 898791-15-6

:

Cyclobutyl(2,4-dichlorophenyl)methanone

Description:
Cyclobutyl(2,4-dichlorophenyl)methanone is an organic compound characterized by its unique structure, which includes a cyclobutyl group and a 2,4-dichlorophenyl moiety attached to a carbonyl functional group. This compound typically exhibits properties common to ketones, such as being a colorless to pale yellow liquid or solid, depending on its specific form and purity. The presence of the dichlorophenyl group suggests that it may possess significant lipophilicity, potentially influencing its solubility in organic solvents while being less soluble in water. The chlorinated aromatic ring can also impart biological activity, making this compound of interest in medicinal chemistry and material science. Additionally, the cyclobutyl group may contribute to the compound's conformational flexibility and steric effects, which can affect its reactivity and interactions with biological targets. Overall, Cyclobutyl(2,4-dichlorophenyl)methanone is a compound of interest for further research, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C11H10Cl2O
InChI:InChI=1S/C11H10Cl2O/c12-8-4-5-9(10(13)6-8)11(14)7-2-1-3-7/h4-7H,1-3H2
InChI key:InChIKey=VKMJMEMSTYACSM-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(Cl)C=C(Cl)C=C1)C2CCC2
Synonyms:
  • Cyclobutyl(2,4-dichlorophenyl)methanone
  • Methanone, cyclobutyl(2,4-dichlorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.