CAS 898791-17-8

1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(3-methylphenyl)-

Description:

1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(3-methylphenyl)-, also known by its CAS number 898791-17-8, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-chloro-5-fluorophenyl group and a 3-methylphenyl group. The presence of halogen atoms, such as chlorine and fluorine, often influences the compound's reactivity and physical properties, including its boiling point and solubility. The aromatic rings contribute to the compound's stability and can affect its electronic properties, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the presence of multiple functional groups may allow for further chemical modifications, enhancing its utility in synthetic chemistry. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those containing both ketone and aromatic functionalities.

Formula: C₁₆H₁₄ClFO

InChI: InChI=1S/C16H14ClFO/c1-11-3-2-4-12(7-11)5-6-16(19)13-8-14(17)10-15(18)9-13/h2-4,7-10H,5-6H2,1H3

InChI key: InChIKey=QMHYJFZACCDQHA-UHFFFAOYSA-N

SMILES: C(CCC1=CC(C)=CC=C1)(=O)C2=CC(Cl)=CC(F)=C2

Synonyms:

• 1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(3-methylphenyl)-
• 3′-Chloro-5′-fluoro-3-(3-methylphenyl)propiophenone

3′-chloro-5′-fluoro-3-(3-methylphenyl)propiophenone

CAS: 898791-17-8

Formula: C₁₆H₁₄ClFO

Purity: 97.0%

Molecular weight: 276.74

Ref: 10-F205707