CymitQuimica logo

CAS 898791-23-6

:

1-(2,3-dichlorophenyl)-3-(m-tolyl)propan-1-one

Description:
1-(2,3-Dichlorophenyl)-3-(m-tolyl)propan-1-one, with the CAS number 898791-23-6, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with a dichlorophenyl group and a m-tolyl group, contributing to its unique chemical properties. The presence of the dichlorophenyl moiety indicates that the compound may exhibit significant electron-withdrawing characteristics, which can influence its reactivity and interactions with other molecules. The m-tolyl group, being a methyl-substituted phenyl group, adds hydrophobic character and can affect the compound's solubility in various solvents. This compound may be of interest in pharmaceutical research or organic synthesis due to its potential biological activity and structural complexity. Additionally, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific arrangement of its substituents and the overall molecular structure. Safety data and handling precautions should be considered when working with this compound, as with any chemical substance.
Formula:C16H14Cl2O
InChI:InChI=1/C16H14Cl2O/c1-11-4-2-5-12(10-11)8-9-15(19)13-6-3-7-14(17)16(13)18/h2-7,10H,8-9H2,1H3
SMILES:Cc1cccc(CCC(=O)c2cccc(c2Cl)Cl)c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.