CAS 898791-24-7

Cyclobutyl(3,5-dichlorophenyl)methanone

Description:

Cyclobutyl(3,5-dichlorophenyl)methanone is an organic compound characterized by its unique structure, which includes a cyclobutyl group and a 3,5-dichlorophenyl moiety attached to a carbonyl functional group. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its specific form and purity. The presence of the cyclobutyl ring contributes to its rigidity and may influence its reactivity and interaction with biological systems. The dichlorophenyl group introduces electron-withdrawing chlorine atoms, which can enhance the compound's electrophilicity and affect its chemical behavior. Cyclobutyl(3,5-dichlorophenyl)methanone may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other complex molecules. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.

Formula: C₁₁H₁₀Cl₂O

InChI: InChI=1/C11H10Cl2O/c12-9-4-8(5-10(13)6-9)11(14)7-2-1-3-7/h4-7H,1-3H2

InChI key: InChIKey=GGJVHMOCRYJAIB-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC(Cl)=C1)C2CCC2

Synonyms:

• Methanone, cyclobutyl(3,5-dichlorophenyl)-
• Cyclobutyl(3,5-dichlorophenyl)methanone