CymitQuimica logo

CAS 898791-25-8

:

2,4-Dichloro-ζ-oxobenzeneheptanoic acid

Description:
2,4-Dichloro-ζ-oxobenzeneheptanoic acid, identified by its CAS number 898791-25-8, is a chemical compound characterized by its unique structure, which includes a heptanoic acid backbone and dichloro-substituted aromatic ring. This compound typically exhibits properties associated with both carboxylic acids and chlorinated aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid functional group. The dichloro substituents can influence its chemical behavior, including its reactivity and potential biological activity. As a synthetic compound, it may be used in various applications, including research in pharmaceuticals or agrochemicals, although specific uses would depend on its biological activity and toxicity profile. Safety data should be consulted to understand its handling and environmental impact, as chlorinated compounds can pose risks to health and ecosystems. Overall, 2,4-Dichloro-ζ-oxobenzeneheptanoic acid represents a complex molecule with potential utility in chemical research and industry.
Formula:C13H14Cl2O3
InChI:InChI=1S/C13H14Cl2O3/c14-9-6-7-10(11(15)8-9)12(16)4-2-1-3-5-13(17)18/h6-8H,1-5H2,(H,17,18)
InChI key:InChIKey=HHTBNQWFQBSLQX-UHFFFAOYSA-N
SMILES:C(CCCCCC(O)=O)(=O)C1=C(Cl)C=C(Cl)C=C1
Synonyms:
  • Benzeneheptanoic acid, 2,4-dichloro-ζ-oxo-
  • 2,4-Dichloro-ζ-oxobenzeneheptanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.