CymitQuimica logo

CAS 898791-27-0

:

2,4-Dichloro-η-oxobenzeneoctanoic acid

Description:
2,4-Dichloro-η-oxobenzeneoctanoic acid, identified by its CAS number 898791-27-0, is a chemical compound that features a unique structure combining both aromatic and aliphatic characteristics. It contains a dichlorobenzene moiety, which contributes to its potential reactivity and interaction with biological systems. The presence of the octanoic acid chain suggests that it may exhibit amphiphilic properties, allowing it to interact with both hydrophilic and hydrophobic environments. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its chlorinated aromatic structure could impart specific properties such as increased stability or altered solubility compared to non-chlorinated analogs. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its characteristics and potential uses. As with many chlorinated compounds, considerations regarding safety and regulatory compliance are essential when handling or utilizing this substance.
Formula:C14H16Cl2O3
InChI:InChI=1S/C14H16Cl2O3/c15-10-7-8-11(12(16)9-10)13(17)5-3-1-2-4-6-14(18)19/h7-9H,1-6H2,(H,18,19)
InChI key:InChIKey=ZWGDNIGSLNPNIF-UHFFFAOYSA-N
SMILES:C(CCCCCCC(O)=O)(=O)C1=C(Cl)C=C(Cl)C=C1
Synonyms:
  • Benzeneoctanoic acid, 2,4-dichloro-η-oxo-
  • 2,4-Dichloro-η-oxobenzeneoctanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.