CAS 898791-31-6
:7-(2,5-dichlorophenyl)-7-oxo-heptanoic acid
Description:
7-(2,5-Dichlorophenyl)-7-oxo-heptanoic acid is a chemical compound characterized by its unique structure, which includes a heptanoic acid backbone with a ketone functional group and a dichlorophenyl substituent. The presence of the 2,5-dichlorophenyl group indicates that the compound has two chlorine atoms attached to the phenyl ring, which can significantly influence its chemical reactivity and biological activity. This compound is likely to exhibit properties typical of carboxylic acids, such as acidity and the ability to form salts and esters. The ketone functional group contributes to its potential reactivity, making it a candidate for various chemical transformations. Additionally, the presence of halogens, like chlorine, can enhance the compound's lipophilicity and may affect its pharmacokinetic properties if it is studied for biological applications. Overall, 7-(2,5-dichlorophenyl)-7-oxo-heptanoic acid is a complex organic molecule with potential implications in medicinal chemistry and material science.
Formula:C13H14Cl2O3
InChI:InChI=1/C13H14Cl2O3/c14-9-6-7-11(15)10(8-9)12(16)4-2-1-3-5-13(17)18/h6-8H,1-5H2,(H,17,18)
SMILES:C(CCC(=O)c1cc(ccc1Cl)Cl)CCC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.