CAS 898791-33-8
:8-(2,5-dichlorophenyl)-8-oxo-octanoic acid
Description:
8-(2,5-Dichlorophenyl)-8-oxo-octanoic acid, identified by its CAS number 898791-33-8, is a synthetic organic compound characterized by its unique structure, which includes an octanoic acid backbone with a ketone functional group and a dichlorophenyl substituent. This compound typically exhibits properties associated with both fatty acids and aromatic compounds, including moderate solubility in organic solvents and limited solubility in water due to its hydrophobic octanoic acid chain. The presence of the dichlorophenyl group may impart specific biological activities, potentially influencing its reactivity and interactions in various chemical environments. Additionally, the compound may exhibit potential applications in pharmaceuticals or agrochemicals, given the presence of both the fatty acid and aromatic moieties, which can enhance bioactivity and molecular interactions. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine atoms, which can pose environmental and health risks. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C14H16Cl2O3
InChI:InChI=1/C14H16Cl2O3/c15-10-7-8-12(16)11(9-10)13(17)5-3-1-2-4-6-14(18)19/h7-9H,1-6H2,(H,18,19)
SMILES:C(CCCC(=O)O)CCC(=O)c1cc(ccc1Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.