CymitQuimica logo

CAS 898791-39-4

:

7-(4-isopropylphenyl)-7-oxo-heptanoic acid

Description:
7-(4-Isopropylphenyl)-7-oxo-heptanoic acid, identified by its CAS number 898791-39-4, is an organic compound characterized by its unique structure that includes a heptanoic acid backbone with a ketone functional group and an isopropyl-substituted phenyl group. This compound typically exhibits properties associated with both carboxylic acids and ketones, such as acidity and potential reactivity in various chemical reactions. The presence of the isopropylphenyl group may influence its solubility, making it more lipophilic, which can affect its biological activity and interaction with other molecules. Additionally, the compound may exhibit specific stereochemical configurations that could impact its reactivity and interactions in biological systems. Its applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and the specific functional groups present. Overall, the characteristics of this compound make it a subject of interest in various fields of chemical research and development.
Formula:C16H22O3
InChI:InChI=1/C16H22O3/c1-12(2)13-8-10-14(11-9-13)15(17)6-4-3-5-7-16(18)19/h8-12H,3-7H2,1-2H3,(H,18,19)
SMILES:CC(C)c1ccc(cc1)C(=O)CCCCCC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.