CAS 898791-41-8
:4-(1-Methylethyl)-η-oxobenzeneoctanoic acid
Description:
4-(1-Methylethyl)-η-oxobenzeneoctanoic acid, identified by its CAS number 898791-41-8, is a chemical compound that features a complex structure characterized by a benzene ring substituted with an isopropyl group and an octanoic acid moiety. This compound likely exhibits properties typical of fatty acids, such as being amphiphilic, which means it has both hydrophilic (water-attracting) and hydrophobic (water-repelling) characteristics. The presence of the isopropyl group may influence its solubility and reactivity, potentially enhancing its lipophilicity. The octanoic acid portion contributes to its fatty acid characteristics, which can affect its biological activity and interactions with other molecules. Such compounds may find applications in various fields, including pharmaceuticals, biochemistry, and materials science, due to their unique structural features. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C17H24O3
InChI:InChI=1S/C17H24O3/c1-13(2)14-9-11-15(12-10-14)16(18)7-5-3-4-6-8-17(19)20/h9-13H,3-8H2,1-2H3,(H,19,20)
InChI key:InChIKey=LKZJNXVLCUICBO-UHFFFAOYSA-N
SMILES:C(CCCCCCC(O)=O)(=O)C1=CC=C(C(C)C)C=C1
Synonyms:- 4-(1-Methylethyl)-η-oxobenzeneoctanoic acid
- Benzeneoctanoic acid, 4-(1-methylethyl)-η-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.