CAS 898791-42-9

Cyclopentyl[2-(methylthio)phenyl]methanone

Description:

Cyclopentyl[2-(methylthio)phenyl]methanone is an organic compound characterized by its unique structure, which includes a cyclopentyl group, a phenyl ring substituted with a methylthio group, and a ketone functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the methylthio group can influence its electronic properties, potentially enhancing its lipophilicity and affecting its interactions in biological systems. Cyclopentyl[2-(methylthio)phenyl]methanone may be utilized in various applications, including pharmaceuticals and organic synthesis, due to its structural features that can facilitate specific chemical reactions. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature, solvent, and the presence of other functional groups. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any potential hazards associated with its use.

Formula: C₁₃H₁₆OS

InChI: InChI=1S/C13H16OS/c1-15-12-9-5-4-8-11(12)13(14)10-6-2-3-7-10/h4-5,8-10H,2-3,6-7H2,1H3

InChI key: InChIKey=DRUWRPTVXGETEY-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(SC)C=CC=C1)C2CCCC2

Synonyms:

• Cyclopentyl[2-(methylthio)phenyl]methanone
• Methanone, cyclopentyl[2-(methylthio)phenyl]-

cyclopentyl 2-thiomethylphenyl ketone

CAS: 898791-42-9

Formula: C₁₃H₁₆OS

Purity: 97.0%

Molecular weight: 220.33

Ref: 10-F204117