CAS 898791-46-3
:cyclopentyl-(3-fluorophenyl)methanone
Description:
Cyclopentyl-(3-fluorophenyl)methanone, identified by its CAS number 898791-46-3, is an organic compound characterized by its unique structure, which includes a cyclopentyl group and a 3-fluorophenyl moiety attached to a carbonyl functional group (ketone). This compound typically exhibits a moderate polarity due to the presence of the carbonyl group, which can engage in hydrogen bonding and dipole-dipole interactions. The fluorine atom on the phenyl ring can influence the compound's reactivity and lipophilicity, potentially enhancing its biological activity. Cyclopentyl groups are known for their ability to provide steric hindrance, which can affect the compound's interaction with biological targets. The compound may be of interest in medicinal chemistry and drug development, particularly in the design of pharmaceuticals that require specific interactions with biological receptors. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the overall structure of the compound.
Formula:C12H13FO
InChI:InChI=1/C12H13FO/c13-11-7-3-6-10(8-11)12(14)9-4-1-2-5-9/h3,6-9H,1-2,4-5H2
SMILES:C1CCC(C1)C(=O)c1cccc(c1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.