CAS 898791-48-5
:cyclopentyl-(2,3-dimethylphenyl)methanone
Description:
Cyclopentyl-(2,3-dimethylphenyl)methanone, with the CAS number 898791-48-5, is an organic compound characterized by its ketone functional group and a complex structure that includes a cyclopentyl group and a dimethyl-substituted phenyl group. This compound typically exhibits a relatively low melting point and moderate solubility in organic solvents, reflecting its hydrophobic nature due to the presence of the cyclopentyl and aromatic rings. The presence of the ketone group suggests potential reactivity in nucleophilic addition reactions, making it a candidate for various synthetic applications in organic chemistry. Additionally, the specific arrangement of substituents on the aromatic ring can influence its electronic properties and reactivity, potentially affecting its behavior in biological systems or as a precursor in chemical synthesis. As with many organic compounds, safety precautions should be observed when handling this substance, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.
Formula:C14H18O
InChI:InChI=1/C14H18O/c1-10-6-5-9-13(11(10)2)14(15)12-7-3-4-8-12/h5-6,9,12H,3-4,7-8H2,1-2H3
SMILES:Cc1cccc(c1C)C(=O)C1CCCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.