CymitQuimica logo

CAS 898791-58-7

:

(4-bromo-3-fluoro-phenyl)-cyclopentyl-methanone

Description:
(4-bromo-3-fluoro-phenyl)-cyclopentyl-methanone, identified by its CAS number 898791-58-7, is a synthetic organic compound characterized by its unique molecular structure, which includes a cyclopentyl group attached to a phenyl ring that is further substituted with bromine and fluorine atoms. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of halogen substituents, such as bromine and fluorine, can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the cyclopentyl moiety may impart certain steric effects that can affect the compound's interactions with biological targets or other chemical species. As a result, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, where the specific arrangement of functional groups can enhance biological activity or selectivity. However, detailed studies on its physical and chemical properties, as well as its biological effects, would be necessary to fully understand its potential applications.
Formula:C12H12BrFO
InChI:InChI=1/C12H12BrFO/c13-10-6-5-9(7-11(10)14)12(15)8-3-1-2-4-8/h5-8H,1-4H2
SMILES:C1CCC(C1)C(=O)c1ccc(c(c1)F)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.