CAS 898791-60-1

(4-Chloro-3-fluorophenyl)cyclopentylmethanone

Description:

(4-Chloro-3-fluorophenyl)cyclopentylmethanone, identified by its CAS number 898791-60-1, is an organic compound characterized by its unique molecular structure, which includes a cyclopentyl group attached to a ketone functional group and a substituted phenyl ring. The presence of chlorine and fluorine atoms on the phenyl ring contributes to its chemical reactivity and potential biological activity. This compound is likely to exhibit moderate lipophilicity due to the cyclopentyl moiety, which can influence its solubility and permeability in biological systems. Additionally, the halogen substituents may enhance its interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound's stability, reactivity, and potential applications can be further explored through various synthetic pathways and analytical techniques, including NMR and mass spectrometry. Overall, (4-Chloro-3-fluorophenyl)cyclopentylmethanone represents a valuable structure for research in organic synthesis and pharmacology.

Formula: C₁₂H₁₂ClFO

InChI: InChI=1/C12H12ClFO/c13-10-6-5-9(7-11(10)14)12(15)8-3-1-2-4-8/h5-8H,1-4H2

InChI key: InChIKey=ZYACAMTZHFMXRL-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(Cl)C=C1)C2CCCC2

Synonyms:

• Methanone, (4-chloro-3-fluorophenyl)cyclopentyl-
• (4-Chloro-3-fluorophenyl)cyclopentylmethanone