CymitQuimica logo

CAS 898791-62-3

:

(3-chloro-4-fluoro-phenyl)-cyclopentyl-methanone

Description:
(3-Chloro-4-fluoro-phenyl)-cyclopentyl-methanone, identified by its CAS number 898791-62-3, is an organic compound characterized by its unique molecular structure, which includes a cyclopentyl group attached to a phenyl ring that is further substituted with chlorine and fluorine atoms. This compound typically exhibits properties associated with both aromatic and aliphatic systems, such as moderate solubility in organic solvents and potential reactivity due to the presence of halogen substituents. The chlorine and fluorine atoms can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its interaction with biological targets. As a ketone, it features a carbonyl group, which can participate in various chemical reactions, including nucleophilic additions. The presence of the cyclopentyl moiety may also contribute to its steric properties, affecting its overall reactivity and stability. This compound may be of interest in pharmaceutical research or materials science due to its structural characteristics and potential applications.
Formula:C12H12ClFO
InChI:InChI=1/C12H12ClFO/c13-10-7-9(5-6-11(10)14)12(15)8-3-1-2-4-8/h5-8H,1-4H2
SMILES:C1CCC(C1)C(=O)c1ccc(c(c1)Cl)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.