CAS 898791-64-5

Cyclopentyl[2-(trifluoromethyl)phenyl]methanone

Description:

Cyclopentyl[2-(trifluoromethyl)phenyl]methanone, with the CAS number 898791-64-5, is an organic compound characterized by its unique structure that includes a cyclopentyl group and a trifluoromethyl-substituted phenyl moiety. This compound typically exhibits a solid state at room temperature and is likely to be relatively stable under standard conditions. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its reactivity and biological activity, making it of interest in pharmaceutical and agrochemical research. The carbonyl functional group (ketone) contributes to its reactivity, allowing for potential participation in various chemical reactions, such as nucleophilic additions. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups and the overall molecular architecture. Safety and handling considerations should be taken into account, as with any chemical substance, particularly regarding its potential toxicity and environmental impact.

Formula: C₁₃H₁₃F₃O

InChI: InChI=1S/C13H13F3O/c14-13(15,16)11-8-4-3-7-10(11)12(17)9-5-1-2-6-9/h3-4,7-9H,1-2,5-6H2

InChI key: InChIKey=PDYIDWQRBBRPBZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C(F)(F)F)C=CC=C1)C2CCCC2

Synonyms:

• Cyclopentyl[2-(trifluoromethyl)phenyl]methanone
• Methanone, cyclopentyl[2-(trifluoromethyl)phenyl]-