CAS 898791-70-3
:(2-chloro-4-fluoro-phenyl)-cyclopentyl-methanone
Description:
(2-Chloro-4-fluoro-phenyl)-cyclopentyl-methanone, with the CAS number 898791-70-3, is an organic compound characterized by its unique molecular structure, which includes a cyclopentyl group attached to a ketone functional group and a phenyl ring substituted with chlorine and fluorine atoms. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential hydrophobic characteristics due to the presence of the phenyl and cyclopentyl groups. The chlorine and fluorine substituents can influence the compound's reactivity, polarity, and overall stability, making it of interest in various chemical applications, including medicinal chemistry and material science. Its specific interactions, such as hydrogen bonding and dipole-dipole interactions, may also be affected by the halogen substituents. As with many organic compounds, safety and handling precautions should be observed, as the presence of halogens can introduce toxicity or environmental concerns. Further studies would be necessary to fully elucidate its physical and chemical properties, as well as its potential applications.
Formula:C12H12ClFO
InChI:InChI=1/C12H12ClFO/c13-11-7-9(14)5-6-10(11)12(15)8-3-1-2-4-8/h5-8H,1-4H2
SMILES:C1CCC(C1)C(=O)c1ccc(cc1Cl)F
Synonyms:- (2-Chloro-4-fluorophenyl)(cyclopentyl)methanone
- Methanone, (2-Chloro-4-Fluorophenyl)Cyclopentyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.