CAS 898791-71-4
:8-(4-ethoxyphenyl)-8-oxo-octanoic acid
Description:
8-(4-Ethoxyphenyl)-8-oxo-octanoic acid, identified by its CAS number 898791-71-4, is an organic compound characterized by its unique structure that includes an octanoic acid backbone with a ketone functional group and an ethoxy-substituted phenyl group. This compound typically exhibits properties associated with both fatty acids and aromatic compounds, which may influence its solubility, reactivity, and potential biological activity. The presence of the ethoxy group suggests moderate hydrophobic characteristics, while the carboxylic acid functional group contributes to its acidity and potential for hydrogen bonding. Such compounds may be of interest in various fields, including pharmaceuticals and materials science, due to their potential applications in drug development or as intermediates in organic synthesis. The specific interactions and stability of this compound can be influenced by environmental factors such as pH and temperature, which are critical for understanding its behavior in different chemical contexts.
Formula:C16H22O4
InChI:InChI=1/C16H22O4/c1-2-20-14-11-9-13(10-12-14)15(17)7-5-3-4-6-8-16(18)19/h9-12H,2-8H2,1H3,(H,18,19)
SMILES:CCOc1ccc(cc1)C(=O)CCCCCCC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.