CAS 898791-72-5
:(3-chloro-5-fluoro-phenyl)-cyclopentyl-methanone
Description:
(3-Chloro-5-fluoro-phenyl)-cyclopentyl-methanone, identified by its CAS number 898791-72-5, is a synthetic organic compound characterized by its unique molecular structure, which includes a cyclopentyl group and a phenyl ring substituted with both chlorine and fluorine atoms. This compound typically exhibits properties associated with ketones, such as being a polar molecule due to the carbonyl group, which can influence its solubility in various solvents. The presence of halogen substituents (chlorine and fluorine) can enhance its reactivity and may impart specific biological activities, making it of interest in pharmaceutical research. The compound's molecular geometry is influenced by the cyclopentyl moiety, which can affect its conformational flexibility. Additionally, the electronic effects of the halogens can modify the compound's chemical reactivity and stability. Overall, (3-chloro-5-fluoro-phenyl)-cyclopentyl-methanone is a compound that may have applications in medicinal chemistry and material science, although specific applications would depend on further research and characterization.
Formula:C12H12ClFO
InChI:InChI=1/C12H12ClFO/c13-10-5-9(6-11(14)7-10)12(15)8-3-1-2-4-8/h5-8H,1-4H2
SMILES:C1CCC(C1)C(=O)c1cc(cc(c1)F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.