CAS 898791-73-6
:5-oxo-5-(4-propoxyphenyl)pentanoic acid
Description:
5-Oxo-5-(4-propoxyphenyl)pentanoic acid is an organic compound characterized by its unique structure, which includes a pentanoic acid backbone with a ketone and a propoxy-substituted phenyl group. This compound features a five-carbon chain with a ketone functional group at the fifth carbon, contributing to its reactivity and potential applications in organic synthesis. The presence of the propoxy group enhances its lipophilicity, which may influence its solubility and interaction with biological systems. As a carboxylic acid, it exhibits acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The compound's specific properties, including melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Due to its structural characteristics, it may have potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. However, detailed studies would be necessary to fully understand its reactivity and potential uses in various fields.
Formula:C14H18O4
InChI:InChI=1/C14H18O4/c1-2-10-18-12-8-6-11(7-9-12)13(15)4-3-5-14(16)17/h6-9H,2-5,10H2,1H3,(H,16,17)
SMILES:CCCOc1ccc(cc1)C(=O)CCCC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.