CAS 898791-74-7

Methanone, (3,4-dimethylphenyl)[3-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (3,4-dimethylphenyl)[3-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. The presence of the 3,4-dimethylphenyl group indicates that it has two methyl substituents on a phenyl ring, enhancing its hydrophobic character. Additionally, the compound features a morpholine moiety, which is a six-membered ring containing both nitrogen and oxygen, contributing to its potential biological activity and solubility properties. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for research in medicinal chemistry. Its molecular interactions can be influenced by the presence of the morpholine group, which can participate in hydrogen bonding and enhance interactions with biological targets. Overall, Methanone, (3,4-dimethylphenyl)[3-(4-morpholinylmethyl)phenyl]- represents a class of compounds that may have applications in drug development or as intermediates in organic synthesis.

Formula: C₂₀H₂₃NO₂

InChI: InChI=1S/C20H23NO2/c1-15-6-7-19(12-16(15)2)20(22)18-5-3-4-17(13-18)14-21-8-10-23-11-9-21/h3-7,12-13H,8-11,14H2,1-2H3

InChI key: InChIKey=KOAHESXSDJDPSV-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCOCC2)=CC=C1)C3=CC(C)=C(C)C=C3

Synonyms:

• (3,4-Dimethylphenyl)[3-(4-morpholinylmethyl)phenyl]methanone
• 3,4-Dimethyl-3′-morpholinomethyl benzophenone
• Methanone, (3,4-dimethylphenyl)[3-(4-morpholinylmethyl)phenyl]-

3,4-dimethyl-3′-morpholinomethyl benzophenone

CAS: 898791-74-7

Formula: C₂₀H₂₃NO₂

Purity: 97.0%

Molecular weight: 309.409

Ref: 10-F204679