CymitQuimica logo

CAS 898791-75-8

:

(4-Chloro-2-fluorophenyl)cyclopentylmethanone

Description:
(4-Chloro-2-fluorophenyl)cyclopentylmethanone, with the CAS number 898791-75-8, is an organic compound characterized by its unique structure, which includes a cyclopentyl group attached to a ketone functional group and a phenyl ring substituted with both chlorine and fluorine atoms. This compound typically exhibits properties associated with aromatic ketones, such as moderate volatility and potential solubility in organic solvents. The presence of halogen substituents (chlorine and fluorine) can influence its reactivity, stability, and biological activity, often enhancing lipophilicity and altering electronic properties. Such modifications may also affect its interactions in biological systems, making it of interest in pharmaceutical research. Additionally, the compound may exhibit specific spectral characteristics in techniques like NMR and IR spectroscopy, which can be utilized for its identification and characterization. Overall, (4-Chloro-2-fluorophenyl)cyclopentylmethanone represents a compound with potential applications in medicinal chemistry and material science, warranting further investigation into its properties and uses.
Formula:C12H12ClFO
InChI:InChI=1S/C12H12ClFO/c13-9-5-6-10(11(14)7-9)12(15)8-3-1-2-4-8/h5-8H,1-4H2
InChI key:InChIKey=IMLUROSOACRTMK-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(F)C=C(Cl)C=C1)C2CCCC2
Synonyms:
  • (4-Chloro-2-fluorophenyl)(cyclopentyl)methanone
  • (4-Chloro-2-fluorophenyl)cyclopentylmethanone
  • Methanone, (4-Chloro-2-Fluorophenyl)Cyclopentyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.