CymitQuimica logo

CAS 898791-77-0

:

(3,5-dimethylphenyl)-[3-(morpholinomethyl)phenyl]methanone

Description:
The chemical substance known as (3,5-dimethylphenyl)-[3-(morpholinomethyl)phenyl]methanone, with the CAS number 898791-77-0, is an organic compound characterized by its complex structure, which includes a ketone functional group and a morpholine moiety. This compound features a phenyl ring substituted with two methyl groups at the 3 and 5 positions, enhancing its hydrophobic characteristics. The presence of the morpholinomethyl group introduces a heterocyclic element, which can contribute to the compound's solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. Additionally, the presence of multiple functional groups may allow for diverse chemical reactivity, making it a candidate for further synthetic modifications. Overall, this compound's unique structural features may lead to interesting applications in medicinal chemistry and material science.
Formula:C20H23NO2
InChI:InChI=1/C20H23NO2/c1-15-10-16(2)12-19(11-15)20(22)18-5-3-4-17(13-18)14-21-6-8-23-9-7-21/h3-5,10-13H,6-9,14H2,1-2H3
SMILES:Cc1cc(C)cc(c1)C(=O)c1cccc(c1)CN1CCOCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.