CAS 898791-80-5

(4-bromo-3-fluoro-phenyl)-[3-(morpholinomethyl)phenyl]methanone

Description:

(4-bromo-3-fluoro-phenyl)-[3-(morpholinomethyl)phenyl]methanone, with the CAS number 898791-80-5, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with both bromine and fluorine atoms, as well as a morpholinomethyl group. This compound typically exhibits properties associated with aromatic ketones, including potential reactivity in electrophilic aromatic substitution reactions due to the presence of electron-withdrawing halogen substituents. The morpholine moiety may contribute to its solubility in polar solvents and influence its biological activity, making it of interest in medicinal chemistry. The presence of multiple functional groups suggests that it may engage in hydrogen bonding and other intermolecular interactions, which can affect its physical properties such as melting point, boiling point, and solubility. Overall, this compound's unique structural features may render it useful in various applications, including pharmaceuticals and agrochemicals, although specific biological activities would require further investigation.

Formula: C₁₈H₁₇BrFNO₂

InChI: InChI=1/C18H17BrFNO2/c19-16-5-4-15(11-17(16)20)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2

SMILES: c1cc(cc(c1)C(=O)c1ccc(c(c1)F)Br)CN1CCOCC1

4-bromo-3-fluoro-3′-morpholinomethyl benzophenone

CAS: 898791-80-5

Formula: C₁₈H₁₇BrFNO₂

Purity: 97.0%

Molecular weight: 378.241

Ref: 10-F204681