CAS 898791-81-6
:Cyclopentyl(2,4-dichlorophenyl)methanone
Description:
Cyclopentyl(2,4-dichlorophenyl)methanone, with the CAS number 898791-81-6, is an organic compound characterized by its unique structure, which includes a cyclopentyl group and a dichlorophenyl moiety attached to a ketone functional group. This compound typically exhibits a solid state at room temperature and is likely to be relatively stable under standard conditions. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, as the presence of the dichlorophenyl group may impart specific biological activities. The compound's solubility is influenced by the hydrophobic cyclopentyl ring and the polar ketone group, which may affect its interactions in various solvents. Additionally, the presence of chlorine atoms can enhance lipophilicity and influence the compound's reactivity and stability. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can exhibit varying degrees of toxicity. Overall, Cyclopentyl(2,4-dichlorophenyl)methanone represents a compound of interest in synthetic organic chemistry and potential applications in medicinal chemistry.
Formula:C12H12Cl2O
InChI:InChI=1S/C12H12Cl2O/c13-9-5-6-10(11(14)7-9)12(15)8-3-1-2-4-8/h5-8H,1-4H2
InChI key:InChIKey=UCMDVNAKOGRENU-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(Cl)C=C(Cl)C=C1)C2CCCC2
Synonyms:- Methanone, cyclopentyl(2,4-dichlorophenyl)-
- Cyclopentyl(2,4-dichlorophenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.