CymitQuimica logo

CAS 898791-83-8

:

(4-chloro-3-fluoro-phenyl)-[3-(morpholinomethyl)phenyl]methanone

Description:
The chemical substance known as (4-chloro-3-fluoro-phenyl)-[3-(morpholinomethyl)phenyl]methanone, with the CAS number 898791-83-8, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with both chloro and fluoro groups, as well as a morpholinomethyl group. This compound typically exhibits properties associated with aromatic ketones, including potential biological activity due to its ability to interact with various biological targets. The presence of halogen substituents (chlorine and fluorine) can influence its lipophilicity, reactivity, and overall pharmacological profile. Morpholine, a cyclic amine, contributes to the compound's potential as a pharmacophore, enhancing its solubility and interaction with biological systems. Such compounds are often investigated for their applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C18H17ClFNO2
InChI:InChI=1/C18H17ClFNO2/c19-16-5-4-15(11-17(16)20)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2
SMILES:c1cc(cc(c1)C(=O)c1ccc(c(c1)F)Cl)CN1CCOCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.