CAS 898791-84-9

Cyclopentyl(2,5-dichlorophenyl)methanone

Description:

Cyclopentyl(2,5-dichlorophenyl)methanone, identified by its CAS number 898791-84-9, is an organic compound characterized by its unique structure, which includes a cyclopentyl group and a 2,5-dichlorophenyl moiety attached to a carbonyl functional group (ketone). This compound typically exhibits a solid state at room temperature and is likely to be relatively stable under standard conditions. The presence of the dichlorophenyl group suggests that it may possess significant electron-withdrawing properties, which can influence its reactivity and interactions with other chemical species. The cyclopentyl group contributes to its hydrophobic character, potentially affecting its solubility in various solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis and applications could be explored in various fields, including medicinal chemistry and materials science. However, specific safety and handling guidelines should be followed due to the presence of chlorine atoms, which can impart toxicity and environmental concerns.

Formula: C₁₂H₁₂Cl₂O

InChI: InChI=1S/C12H12Cl2O/c13-9-5-6-11(14)10(7-9)12(15)8-3-1-2-4-8/h5-8H,1-4H2

InChI key: InChIKey=ANOKAZMIUAFKFI-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=CC(Cl)=C1)C2CCCC2

Synonyms:

• Cyclopentyl(2,5-dichlorophenyl)methanone
• Methanone, cyclopentyl(2,5-dichlorophenyl)-