CAS 898791-86-1
:Methanone, (3-chloro-4-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]-
Description:
Methanone, (3-chloro-4-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of chlorine and fluorine substituents on the phenyl rings contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The morpholine moiety suggests that the compound may exhibit properties relevant to medicinal chemistry, possibly serving as a scaffold for drug development. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic aromatic components. Its molecular interactions may be significant in biological systems, making it a candidate for further investigation in pharmacological studies. Safety data and handling precautions should be considered, as with any chemical substance, particularly those with halogenated groups, which can pose environmental and health risks.
Formula:C18H17ClFNO2
InChI:InChI=1S/C18H17ClFNO2/c19-16-11-15(4-5-17(16)20)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2
InChI key:InChIKey=OTPXHBYUEIYAPQ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(CN2CCOCC2)=CC=C1)C3=CC(Cl)=C(F)C=C3
Synonyms:- Methanone, (3-chloro-4-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]-
- 3-Chloro-4-fluoro-3′-morpholinomethyl benzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.