CAS 898791-89-4

(2-chlorophenyl)-[3-(morpholinomethyl)phenyl]methanone

Description:

(2-chlorophenyl)-[3-(morpholinomethyl)phenyl]methanone, identified by its CAS number 898791-89-4, is a synthetic organic compound characterized by its complex structure, which includes a chlorophenyl group and a morpholinomethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the morpholine ring suggests that it may engage in hydrogen bonding, influencing its interactions with biological targets or other chemical species. Additionally, the chlorophenyl moiety may impart specific electronic properties, affecting the compound's overall stability and reactivity. Such characteristics make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its precise behavior in chemical reactions, biological activity, and potential applications would depend on further empirical studies and characterization techniques, including spectroscopy and chromatography, to elucidate its properties and efficacy in various contexts.

Formula: C₁₈H₁₈ClNO₂

InChI: InChI=1/C18H18ClNO2/c19-17-7-2-1-6-16(17)18(21)15-5-3-4-14(12-15)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2

SMILES: c1ccc(c(c1)C(=O)c1cccc(c1)CN1CCOCC1)Cl

2-chloro-3′-morpholinomethyl benzophenone

CAS: 898791-89-4

Formula: C₁₈H₁₈ClNO₂

Purity: 97.0%

Molecular weight: 315.8

Ref: 10-F204684