CAS 898791-92-9
:(2-fluorophenyl)-[3-(morpholinomethyl)phenyl]methanone
Description:
The chemical substance known as (2-fluorophenyl)-[3-(morpholinomethyl)phenyl]methanone, with the CAS number 898791-92-9, is an organic compound characterized by its complex structure, which includes a fluorophenyl group and a morpholinomethyl substituent. This compound typically exhibits properties associated with aromatic ketones, including potential reactivity due to the presence of the carbonyl group. The fluorine atom in the 2-position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its biological activity. The morpholine ring contributes to the compound's solubility and may play a role in interactions with biological targets. Such compounds are often investigated for their potential pharmaceutical applications, particularly in the development of drugs targeting specific receptors or enzymes. The presence of both aromatic and heterocyclic components suggests that this substance may exhibit interesting chemical behavior, including possible hydrogen bonding and π-π stacking interactions, which are relevant in medicinal chemistry and material science.
Formula:C18H18FNO2
InChI:InChI=1/C18H18FNO2/c19-17-7-2-1-6-16(17)18(21)15-5-3-4-14(12-15)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2
SMILES:c1ccc(c(c1)C(=O)c1cccc(c1)CN1CCOCC1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.