CAS 898791-96-3
:cyclopentyl-(3,4-difluorophenyl)methanone
Description:
Cyclopentyl-(3,4-difluorophenyl)methanone, identified by its CAS number 898791-96-3, is an organic compound characterized by its unique structure, which includes a cyclopentyl group and a 3,4-difluorophenyl moiety attached to a ketone functional group. This compound typically exhibits properties associated with ketones, such as being a polar molecule due to the carbonyl group, which can engage in hydrogen bonding with solvents. The presence of fluorine atoms in the phenyl ring can influence its reactivity and stability, often enhancing lipophilicity and altering electronic properties. Cyclopentyl groups contribute to the compound's steric bulk, potentially affecting its biological activity and interactions with other molecules. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development or as a building block in organic synthesis. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would require experimental determination or detailed literature references for precise values.
Formula:C12H12F2O
InChI:InChI=1/C12H12F2O/c13-10-6-5-9(7-11(10)14)12(15)8-3-1-2-4-8/h5-8H,1-4H2
SMILES:C1CCC(C1)C(=O)c1ccc(c(c1)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.