CAS 898791-97-4
:5-oxo-5-(4-pentoxyphenyl)pentanoic acid
Description:
5-Oxo-5-(4-pentoxyphenyl)pentanoic acid is an organic compound characterized by its functional groups and structural features. It contains a pentanoic acid backbone, which is a five-carbon chain with a carboxylic acid group (-COOH) at one end. The presence of a ketone group (5-oxo) indicates that there is a carbonyl (C=O) functional group within the carbon chain. The compound also features a phenyl ring substituted with a pentoxy group, which is a phenyl ring with a pentoxy (C5H11O) substituent, enhancing its hydrophobic characteristics. This structure suggests that the compound may exhibit both polar and non-polar properties, potentially influencing its solubility and reactivity. The presence of multiple functional groups may also allow for various chemical reactions, making it of interest in synthetic organic chemistry and potentially in pharmaceutical applications. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment.
Formula:C16H22O4
InChI:InChI=1/C16H22O4/c1-2-3-4-12-20-14-10-8-13(9-11-14)15(17)6-5-7-16(18)19/h8-11H,2-7,12H2,1H3,(H,18,19)
SMILES:CCCCCOc1ccc(cc1)C(=O)CCCC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.