CAS 898792-04-6
:(4-bromo-2-fluoro-phenyl)-[3-(morpholinomethyl)phenyl]methanone
Description:
(4-bromo-2-fluoro-phenyl)-[3-(morpholinomethyl)phenyl]methanone, identified by its CAS number 898792-04-6, is a synthetic organic compound characterized by its complex molecular structure. It features a phenyl ring substituted with both bromine and fluorine atoms, which can influence its reactivity and biological activity. The presence of a morpholinomethyl group suggests potential applications in medicinal chemistry, as morpholine derivatives are often associated with various pharmacological properties. This compound may exhibit specific interactions with biological targets due to its unique functional groups, making it of interest in drug discovery and development. Additionally, the presence of halogen substituents can enhance lipophilicity and alter the compound's solubility profile, affecting its bioavailability. Overall, the characteristics of this compound, including its molecular weight, solubility, and stability, would be essential for understanding its potential applications in research and industry. Further studies would be necessary to elucidate its specific properties and potential uses in various fields, including pharmaceuticals and agrochemicals.
Formula:C18H17BrFNO2
InChI:InChI=1S/C18H17BrFNO2/c19-15-4-5-16(17(20)11-15)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2
InChI key:InChIKey=CVSONSAFKIZRTD-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(F)C=C(Br)C=C1)C2=CC(CN3CCOCC3)=CC=C2
Synonyms:- Methanone, (4-bromo-2-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]-
- (4-Bromo-2-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.