CAS 898792-06-8
:8-oxo-8-(4-pentoxyphenyl)octanoic acid
Description:
8-Oxo-8-(4-pentoxyphenyl)octanoic acid, identified by its CAS number 898792-06-8, is a synthetic organic compound characterized by its unique structure, which includes an octanoic acid backbone with an oxo group and a pentoxyphenyl substituent. This compound typically exhibits properties associated with both fatty acids and aromatic compounds, potentially influencing its solubility and reactivity. The presence of the oxo group suggests that it may participate in various chemical reactions, such as oxidation or reduction processes. The pentoxyphenyl group can impart hydrophobic characteristics, affecting its interaction with biological membranes and its overall bioavailability. Such compounds may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to their potential biological activity. Additionally, the structural features may allow for specific interactions with biological targets, making it a candidate for further research in drug design or material science. However, detailed studies would be necessary to fully elucidate its properties and applications.
Formula:C19H28O4
InChI:InChI=1/C19H28O4/c1-2-3-8-15-23-17-13-11-16(12-14-17)18(20)9-6-4-5-7-10-19(21)22/h11-14H,2-10,15H2,1H3,(H,21,22)
SMILES:CCCCCOc1ccc(cc1)C(=O)CCCCCCC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.