CAS 898792-07-9

Methanone, (2-chloro-4-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (2-chloro-4-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl rings contributes to its unique chemical reactivity and potential biological activity. The morpholine moiety indicates that the compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the overall molecular structure and the electronic effects of the substituents. Safety and handling precautions should be observed, as with many synthetic organic compounds, due to potential toxicity or environmental impact. Further studies would be necessary to fully elucidate its properties and applications.

Formula: C₁₈H₁₇ClFNO₂

InChI: InChI=1S/C18H17ClFNO2/c19-17-11-15(20)4-5-16(17)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2

InChI key: InChIKey=LJJXPLCCBPGGBG-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=C(F)C=C1)C2=CC(CN3CCOCC3)=CC=C2

Synonyms:

• Methanone, (2-chloro-4-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]-
• (2-Chloro-4-fluorophenyl)[3-(4-morpholinylmethyl)phenyl]methanone
• 2-Chloro-4-fluoro-3′-morpholinomethyl benzophenone